C22H32F2N4 — CID 145238591
(E)-1-[4-[[1-(1-ethylazetidin-3-yl)piperidin-4-yl]methyl]phenyl]-4,4-difluoro-N-(methylideneamino)butan-1-imine (PubChem CID 145238591) has the molecular formula C22H32F2N4 and a molecular weight of 390.52 g/mol. Its IUPAC name is (E)-1-[4-[[1-(1-ethylazetidin-3-yl)piperidin-4-yl]methyl]phenyl]-4,4-difluoro-N-(methylideneamino)butan-1-imine.
| Compound Name | (E)-1-[4-[[1-(1-ethylazetidin-3-yl)piperidin-4-yl]methyl]phenyl]-4,4-difluoro-N-(methylideneamino)butan-1-imine |
|---|---|
| PubChem CID | 145238591 |
| Molecular Formula | C22H32F2N4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (E)-1-[4-[[1-(1-ethylazetidin-3-yl)piperidin-4-yl]methyl]phenyl]-4,4-difluoro-N-(methylideneamino)butan-1-imine |
| SMILES | C=N/N=C(\CCC(F)F)c1ccc(CC2CCN(C3CN(CC)C3)CC2)cc1 |
| InChI | InChI=1S/C22H32F2N4/c1-3-27-15-20(16-27)28-12-10-18(11-13-28)14-17-4-6-19(7-5-17)21(26-25-2)8-9-22(23)24/h4-7,18,20,22H,2-3,8-16H2,1H3/b26-21+ |
| InChIKey | YTDRZZSQZWOMMP-YYADALCUSA-N |
| XLogP | 4.10 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|