C22H31N5O2 — CID 145241325
[1-(1H-indol-3-yl)propan-2-ylamino]-[2-(4-propan-2-ylpiperazin-1-yl)-1,3-oxazol-5-yl]methanol (PubChem CID 145241325) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is [1-(1H-indol-3-yl)propan-2-ylamino]-[2-(4-propan-2-ylpiperazin-1-yl)-1,3-oxazol-5-yl]methanol.
| Compound Name | [1-(1H-indol-3-yl)propan-2-ylamino]-[2-(4-propan-2-ylpiperazin-1-yl)-1,3-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 145241325 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | [1-(1H-indol-3-yl)propan-2-ylamino]-[2-(4-propan-2-ylpiperazin-1-yl)-1,3-oxazol-5-yl]methanol |
| SMILES | CC(Cc1c[nH]c2ccccc12)NC(O)c1cnc(N2CCN(C(C)C)CC2)o1 |
| InChI | InChI=1S/C22H31N5O2/c1-15(2)26-8-10-27(11-9-26)22-24-14-20(29-22)21(28)25-16(3)12-17-13-23-19-7-5-4-6-18(17)19/h4-7,13-16,21,23,25,28H,8-12H2,1-3H3 |
| InChIKey | PBPMRJYARZLGJZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|