C13H21N3O — CID 145241366
1-[4-[(4Z)-1-(methylideneamino)hexa-2,4-dien-3-yl]piperazin-1-yl]ethanone (PubChem CID 145241366) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[4-[(4Z)-1-(methylideneamino)hexa-2,4-dien-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(4Z)-1-(methylideneamino)hexa-2,4-dien-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 145241366 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-[4-[(4Z)-1-(methylideneamino)hexa-2,4-dien-3-yl]piperazin-1-yl]ethanone |
| SMILES | C=NCC=C(/C=C\C)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C13H21N3O/c1-4-5-13(6-7-14-3)16-10-8-15(9-11-16)12(2)17/h4-6H,3,7-11H2,1-2H3/b5-4-,13-6? |
| InChIKey | ISEIMHDENDDNLL-YNKGCHTASA-N |
| XLogP | 1.31 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|