C9H18N2S — CID 145242260
(3aR,6aR)-3a,5,6a-trimethyl-1-sulfanyl-2,3,4,6-tetrahydropyrrolo[2,3-c]pyrrole (PubChem CID 145242260) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is (3aR,6aR)-3a,5,6a-trimethyl-1-sulfanyl-2,3,4,6-tetrahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aR,6aR)-3a,5,6a-trimethyl-1-sulfanyl-2,3,4,6-tetrahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 145242260 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (3aR,6aR)-3a,5,6a-trimethyl-1-sulfanyl-2,3,4,6-tetrahydropyrrolo[2,3-c]pyrrole |
| SMILES | CN1C[C@@]2(C)CCN(S)[C@@]2(C)C1 |
| InChI | InChI=1S/C9H18N2S/c1-8-4-5-11(12)9(8,2)7-10(3)6-8/h12H,4-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | KFZYFJZCSLOBPJ-BDAKNGLRSA-N |
| XLogP | 1.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|