C18H27N — CID 145242371
2,4-dimethyl-7-[(3Z)-4,6,6-trimethylhepta-1,3-dien-3-yl]-2H-azepine (PubChem CID 145242371) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 2,4-dimethyl-7-[(3Z)-4,6,6-trimethylhepta-1,3-dien-3-yl]-2H-azepine.
| Compound Name | 2,4-dimethyl-7-[(3Z)-4,6,6-trimethylhepta-1,3-dien-3-yl]-2H-azepine |
|---|---|
| PubChem CID | 145242371 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2,4-dimethyl-7-[(3Z)-4,6,6-trimethylhepta-1,3-dien-3-yl]-2H-azepine |
| SMILES | C=C/C(C1=NC(C)C=C(C)C=C1)=C(\C)CC(C)(C)C |
| InChI | InChI=1S/C18H27N/c1-8-16(14(3)12-18(5,6)7)17-10-9-13(2)11-15(4)19-17/h8-11,15H,1,12H2,2-7H3/b16-14- |
| InChIKey | RINPBDYOIRLCIM-PEZBUJJGSA-N |
| XLogP | 5.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|