C33H33FN6S — CID 145254521
(3E,5E)-N-(1-cyclohexylethenyl)-5-[3-[4-(2-fluorophenyl)-2,7-dihydropyrrolo[3,2-e]thiazin-6-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine (PubChem CID 145254521) has the molecular formula C33H33FN6S and a molecular weight of 564.73 g/mol. Its IUPAC name is (3E,5E)-N-(1-cyclohexylethenyl)-5-[3-[4-(2-fluorophenyl)-2,7-dihydropyrrolo[3,2-e]thiazin-6-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-(1-cyclohexylethenyl)-5-[3-[4-(2-fluorophenyl)-2,7-dihydropyrrolo[3,2-e]thiazin-6-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145254521 |
| Molecular Formula | C33H33FN6S |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (3E,5E)-N-(1-cyclohexylethenyl)-5-[3-[4-(2-fluorophenyl)-2,7-dihydropyrrolo[3,2-e]thiazin-6-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c([nH]3)SNC=C4c3ccccc3F)c2n1)NC(=C)C1CCCCC1 |
| InChI | InChI=1S/C33H33FN6S/c1-4-21(17-23(5-2)36-20(3)22-11-7-6-8-12-22)28-15-16-29-31(37-28)32(40-39-29)30-18-25-26(19-35-41-33(25)38-30)24-13-9-10-14-27(24)34/h4-5,9-10,13-19,22,35-36,38H,2-3,6-8,11-12H2,1H3,(H,39,40)/b21-4+,23-17+ |
| InChIKey | ZZQVANOJLGGOKR-AUNADVNHSA-N |
| XLogP | 8.25 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|