C10H19N3 — CID 145259352
2-amino-3-methyl-N'-[(E)-pent-1-enyl]but-2-enimidamide (PubChem CID 145259352) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-amino-3-methyl-N'-[(E)-pent-1-enyl]but-2-enimidamide.
| Compound Name | 2-amino-3-methyl-N'-[(E)-pent-1-enyl]but-2-enimidamide |
|---|---|
| PubChem CID | 145259352 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 2-amino-3-methyl-N'-[(E)-pent-1-enyl]but-2-enimidamide |
| SMILES | CCC/C=C/N=C(\N)C(N)=C(C)C |
| InChI | InChI=1S/C10H19N3/c1-4-5-6-7-13-10(12)9(11)8(2)3/h6-7H,4-5,11H2,1-3H3,(H2,12,13)/b7-6+ |
| InChIKey | RWQGVBKPOLBEKJ-VOTSOKGWSA-N |
| XLogP | 1.91 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|