C9H16F2N2 — CID 145259611
3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine (PubChem CID 145259611) has the molecular formula C9H16F2N2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine.
| Compound Name | 3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 145259611 |
| Molecular Formula | C9H16F2N2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 3-[2-(3,3-difluoroazetidin-1-yl)ethyl]pyrrolidine |
| SMILES | FC1(F)CN(CCC2CCNC2)C1 |
| InChI | InChI=1S/C9H16F2N2/c10-9(11)6-13(7-9)4-2-8-1-3-12-5-8/h8,12H,1-7H2 |
| InChIKey | PMPPOPGPYJAKPT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |