C38H34S2 — CID 145260077
6,6,12,12-tetramethyl-2,8-bis(2-methylsulfanylphenyl)indeno[1,2-b]fluorene (PubChem CID 145260077) has the molecular formula C38H34S2 and a molecular weight of 554.82 g/mol. Its IUPAC name is 6,6,12,12-tetramethyl-2,8-bis(2-methylsulfanylphenyl)indeno[1,2-b]fluorene.
| Compound Name | 6,6,12,12-tetramethyl-2,8-bis(2-methylsulfanylphenyl)indeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 145260077 |
| Molecular Formula | C38H34S2 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 6,6,12,12-tetramethyl-2,8-bis(2-methylsulfanylphenyl)indeno[1,2-b]fluorene |
| SMILES | CSc1ccccc1-c1ccc2c(c1)C(C)(C)c1cc3c(cc1-2)C(C)(C)c1cc(-c2ccccc2SC)ccc1-3 |
| InChI | InChI=1S/C38H34S2/c1-37(2)31-19-23(25-11-7-9-13-35(25)39-5)15-17-27(31)29-22-34-30(21-33(29)37)28-18-16-24(20-32(28)38(34,3)4)26-12-8-10-14-36(26)40-6/h7-22H,1-6H3 |
| InChIKey | XZJNOKNDTPOWAV-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |