C16H13Cl2F3N2OS — CID 145267128
3-[2,4-dichloro-5-(2-methylprop-2-enylsulfanyl)phenyl]-1-methyl-6-(trifluoromethyl)pyridazin-4-one (PubChem CID 145267128) has the molecular formula C16H13Cl2F3N2OS and a molecular weight of 409.26 g/mol. Its IUPAC name is 3-[2,4-dichloro-5-(2-methylprop-2-enylsulfanyl)phenyl]-1-methyl-6-(trifluoromethyl)pyridazin-4-one.
| Compound Name | 3-[2,4-dichloro-5-(2-methylprop-2-enylsulfanyl)phenyl]-1-methyl-6-(trifluoromethyl)pyridazin-4-one |
|---|---|
| PubChem CID | 145267128 |
| Molecular Formula | C16H13Cl2F3N2OS |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 3-[2,4-dichloro-5-(2-methylprop-2-enylsulfanyl)phenyl]-1-methyl-6-(trifluoromethyl)pyridazin-4-one |
| SMILES | C=C(C)CSc1cc(-c2nn(C)c(C(F)(F)F)cc2=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2F3N2OS/c1-8(2)7-25-13-4-9(10(17)5-11(13)18)15-12(24)6-14(16(19,20)21)23(3)22-15/h4-6H,1,7H2,2-3H3 |
| InChIKey | ZOMCJEIPZWJDGK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|