C15H9Cl2F7N2O2 — CID 145266956
3-[2,4-dichloro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-1-methyl-6-(trifluoromethyl)pyridazin-4-one (PubChem CID 145266956) has the molecular formula C15H9Cl2F7N2O2 and a molecular weight of 453.14 g/mol. Its IUPAC name is 3-[2,4-dichloro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-1-methyl-6-(trifluoromethyl)pyridazin-4-one.
| Compound Name | 3-[2,4-dichloro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-1-methyl-6-(trifluoromethyl)pyridazin-4-one |
|---|---|
| PubChem CID | 145266956 |
| Molecular Formula | C15H9Cl2F7N2O2 |
| Molecular Weight | 453.14 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 3-[2,4-dichloro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-1-methyl-6-(trifluoromethyl)pyridazin-4-one |
| SMILES | Cn1nc(-c2cc(OCC(F)(F)C(F)F)c(Cl)cc2Cl)c(=O)cc1C(F)(F)F |
| InChI | InChI=1S/C15H9Cl2F7N2O2/c1-26-11(15(22,23)24)4-9(27)12(25-26)6-2-10(8(17)3-7(6)16)28-5-14(20,21)13(18)19/h2-4,13H,5H2,1H3 |
| InChIKey | XYALHCHFBWSMAS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.14 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|