C14H11ClF4N2O3 — CID 151942591
methyl 2-[2-chloro-4-fluoro-5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenoxy]acetate (PubChem CID 151942591) has the molecular formula C14H11ClF4N2O3 and a molecular weight of 366.70 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-fluoro-5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-4-fluoro-5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 151942591 |
| Molecular Formula | C14H11ClF4N2O3 |
| Molecular Weight | 366.70 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | methyl 2-[2-chloro-4-fluoro-5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenoxy]acetate |
| SMILES | COC(=O)COc1cc(-c2cc(C(F)(F)F)n(C)n2)c(F)cc1Cl |
| InChI | InChI=1S/C14H11ClF4N2O3/c1-21-12(14(17,18)19)5-10(20-21)7-3-11(8(15)4-9(7)16)24-6-13(22)23-2/h3-5H,6H2,1-2H3 |
| InChIKey | TUZJPCSJHXIUOJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |