About cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one
cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one (PubChem CID 145268956) has the molecular formula C12H22N4O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one |
| PubChem CID | 145268956 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one |
| SMILES | NC1CCCCC1.O=c1ccnc(NCCO)[nH]1 |
| InChI | InChI=1S/C6H9N3O2.C6H13N/c10-4-3-8-6-7-2-1-5(11)9-6;7-6-4-2-1-3-5-6/h1-2,10H,3-4H2,(H2,7,8,9,11);6H,1-5,7H2 |
| InChIKey | POFLYSFIKMENKC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one?
The IUPAC name of cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one (CID 145268956) is cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one.
What is the SMILES notation for cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one?
The canonical SMILES for cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one is NC1CCCCC1.O=c1ccnc(NCCO)[nH]1.
What is the InChIKey of cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one?
The InChIKey is POFLYSFIKMENKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2.C6H13N/c10-4-3-8-6-7-2-1-5(11)9-6;7-6-4-2-1-3-5-6/h1-2,10H,3-4H2,(H2,7,8,9,11);6H,1-5,7H2.
What are the key properties of cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one?
cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one has a molecular weight of 254.33 g/mol, XLogP of 0.45, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;2-(2-hydroxyethylamino)-1H-pyrimidin-6-one is sourced from PubChem (CID 145268956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).