C12H19N3O6 — CID 24740853
2-[2-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]methoxy]ethylamino]-1H-pyrimidin-6-one (PubChem CID 24740853) has the molecular formula C12H19N3O6 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-[2-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]methoxy]ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]methoxy]ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 24740853 |
| Molecular Formula | C12H19N3O6 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[2-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-methoxyoxolan-2-yl]methoxy]ethylamino]-1H-pyrimidin-6-one |
| SMILES | CO[C@@H]1O[C@H](COCCNc2nccc(=O)[nH]2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H19N3O6/c1-19-11-10(18)9(17)7(21-11)6-20-5-4-14-12-13-3-2-8(16)15-12/h2-3,7,9-11,17-18H,4-6H2,1H3,(H2,13,14,15,16)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | BJYMHPFSEWQZLY-QCNRFFRDSA-N |
| XLogP | -1.71 |
| TPSA | 125.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|