C24H22F4N6S — CID 145271755
(E,3R,5S)-N-[8-[4-fluoro-2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-7-(3-methyl-1,2-thiazol-5-yl)-7-azatricyclo[3.3.0.01,3]octan-4-imine (PubChem CID 145271755) has the molecular formula C24H22F4N6S and a molecular weight of 502.54 g/mol. Its IUPAC name is (E,3R,5S)-N-[8-[4-fluoro-2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-7-(3-methyl-1,2-thiazol-5-yl)-7-azatricyclo[3.3.0.01,3]octan-4-imine.
| Compound Name | (E,3R,5S)-N-[8-[4-fluoro-2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-7-(3-methyl-1,2-thiazol-5-yl)-7-azatricyclo[3.3.0.01,3]octan-4-imine |
|---|---|
| PubChem CID | 145271755 |
| Molecular Formula | C24H22F4N6S |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | (E,3R,5S)-N-[8-[4-fluoro-2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-7-(3-methyl-1,2-thiazol-5-yl)-7-azatricyclo[3.3.0.01,3]octan-4-imine |
| SMILES | Cc1cc(N2C[C@H]3/C(=N/c4nc5n(n4)CCCC5c4ccc(F)cc4C(F)(F)F)[C@@H]4CC34C2)sn1 |
| InChI | InChI=1S/C24H22F4N6S/c1-12-7-19(35-32-12)33-10-18-20(17-9-23(17,18)11-33)29-22-30-21-15(3-2-6-34(21)31-22)14-5-4-13(25)8-16(14)24(26,27)28/h4-5,7-8,15,17-18H,2-3,6,9-11H2,1H3/b29-20+/t15?,17-,18-,23?/m0/s1 |
| InChIKey | NEFJDBYNZJLAOJ-BKUROUBYSA-N |
| XLogP | 5.36 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|