C21H16F3IN4 — CID 136619880
2-(5-iodo-1H-indol-2-yl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 136619880) has the molecular formula C21H16F3IN4 and a molecular weight of 508.29 g/mol. Its IUPAC name is 2-(5-iodo-1H-indol-2-yl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(5-iodo-1H-indol-2-yl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 136619880 |
| Molecular Formula | C21H16F3IN4 |
| Molecular Weight | 508.29 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 2-(5-iodo-1H-indol-2-yl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | FC(F)(F)c1ccccc1C1CCCn2nc(-c3cc4cc(I)ccc4[nH]3)nc21 |
| InChI | InChI=1S/C21H16F3IN4/c22-21(23,24)16-6-2-1-4-14(16)15-5-3-9-29-20(15)27-19(28-29)18-11-12-10-13(25)7-8-17(12)26-18/h1-2,4,6-8,10-11,15,26H,3,5,9H2 |
| InChIKey | YEPMVZDFVUZNCU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.29 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|