C25H21F3N4O — CID 56969604
2-(3-methoxy-4-pyridin-4-ylphenyl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 56969604) has the molecular formula C25H21F3N4O and a molecular weight of 450.46 g/mol. Its IUPAC name is 2-(3-methoxy-4-pyridin-4-ylphenyl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(3-methoxy-4-pyridin-4-ylphenyl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 56969604 |
| Molecular Formula | C25H21F3N4O |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-(3-methoxy-4-pyridin-4-ylphenyl)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(-c2nc3n(n2)CCCC3c2ccccc2C(F)(F)F)ccc1-c1ccncc1 |
| InChI | InChI=1S/C25H21F3N4O/c1-33-22-15-17(8-9-18(22)16-10-12-29-13-11-16)23-30-24-20(6-4-14-32(24)31-23)19-5-2-3-7-21(19)25(26,27)28/h2-3,5,7-13,15,20H,4,6,14H2,1H3 |
| InChIKey | KVWIRJHUHZTNEE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |