C10H16N2 — CID 145274792
(3E,4Z)-4-ethylidene-3-prop-2-enylidenepiperidin-1-amine (PubChem CID 145274792) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (3E,4Z)-4-ethylidene-3-prop-2-enylidenepiperidin-1-amine.
| Compound Name | (3E,4Z)-4-ethylidene-3-prop-2-enylidenepiperidin-1-amine |
|---|---|
| PubChem CID | 145274792 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (3E,4Z)-4-ethylidene-3-prop-2-enylidenepiperidin-1-amine |
| SMILES | C=C/C=C1/CN(N)CC/C1=C/C |
| InChI | InChI=1S/C10H16N2/c1-3-5-10-8-12(11)7-6-9(10)4-2/h3-5H,1,6-8,11H2,2H3/b9-4-,10-5- |
| InChIKey | BQGYKGUIBIQGQW-AVWDGMTFSA-N |
| XLogP | 1.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|