About (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine
(3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine (PubChem CID 130279657) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine.
Molecular Properties
| Compound Name | (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine |
| PubChem CID | 130279657 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine |
| SMILES | C=C/C=C1/CCN(C)C/C1=C/C=C |
| InChI | InChI=1S/C12H17N/c1-4-6-11-8-9-13(3)10-12(11)7-5-2/h4-7H,1-2,8-10H2,3H3/b11-6-,12-7- |
| InChIKey | VBGNHJAXNHWFJJ-IODUZNRKSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine?
The IUPAC name of (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine (CID 130279657) is (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine.
What is the SMILES notation for (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine?
The canonical SMILES for (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine is C=C/C=C1/CCN(C)C/C1=C/C=C.
What is the InChIKey of (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine?
The InChIKey is VBGNHJAXNHWFJJ-IODUZNRKSA-N. The full InChI is InChI=1S/C12H17N/c1-4-6-11-8-9-13(3)10-12(11)7-5-2/h4-7H,1-2,8-10H2,3H3/b11-6-,12-7-.
What are the key properties of (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine?
(3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine has a molecular weight of 175.27 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4Z)-1-methyl-3,4-bis(prop-2-enylidene)piperidine is sourced from PubChem (CID 130279657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).