C15H17FN2O2 — CID 145278996
ethane;8-fluoro-4,9-dimethyl-[1,4]oxazino[3,2-c]quinolin-3-one (PubChem CID 145278996) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is ethane;8-fluoro-4,9-dimethyl-[1,4]oxazino[3,2-c]quinolin-3-one.
| Compound Name | ethane;8-fluoro-4,9-dimethyl-[1,4]oxazino[3,2-c]quinolin-3-one |
|---|---|
| PubChem CID | 145278996 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | ethane;8-fluoro-4,9-dimethyl-[1,4]oxazino[3,2-c]quinolin-3-one |
| SMILES | CC.Cc1cc2c3c(cnc2cc1F)N(C)C(=O)CO3 |
| InChI | InChI=1S/C13H11FN2O2.C2H6/c1-7-3-8-10(4-9(7)14)15-5-11-13(8)18-6-12(17)16(11)2;1-2/h3-5H,6H2,1-2H3;1-2H3 |
| InChIKey | VRAFXBILXFMLCA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |