C22H25F2N5O4S — CID 145279854
N-[2-[(8aR)-4a-methyl-2-methyliminospiro[1,4,5,8-tetrahydropyrano[3,4-d][1,3]oxazine-6,1'-cyclobutane]-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide (PubChem CID 145279854) has the molecular formula C22H25F2N5O4S and a molecular weight of 493.54 g/mol. Its IUPAC name is N-[2-[(8aR)-4a-methyl-2-methyliminospiro[1,4,5,8-tetrahydropyrano[3,4-d][1,3]oxazine-6,1'-cyclobutane]-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide.
| Compound Name | N-[2-[(8aR)-4a-methyl-2-methyliminospiro[1,4,5,8-tetrahydropyrano[3,4-d][1,3]oxazine-6,1'-cyclobutane]-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 145279854 |
| Molecular Formula | C22H25F2N5O4S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[2-[(8aR)-4a-methyl-2-methyliminospiro[1,4,5,8-tetrahydropyrano[3,4-d][1,3]oxazine-6,1'-cyclobutane]-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
| SMILES | C/N=C1/N[C@@]2(c3nc(NC(=O)c4ccc(OC(F)F)cn4)cs3)COC3(CCC3)CC2(C)CO1 |
| InChI | InChI=1S/C22H25F2N5O4S/c1-20-10-21(6-3-7-21)32-12-22(20,29-19(25-2)31-11-20)17-28-15(9-34-17)27-16(30)14-5-4-13(8-26-14)33-18(23)24/h4-5,8-9,18H,3,6-7,10-12H2,1-2H3,(H,25,29)(H,27,30)/t20?,22-/m1/s1 |
| InChIKey | IMIGGTMKIBHTBL-LWMIZPGFSA-N |
| XLogP | 3.54 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|