C17H20F2N6O4S2 — CID 126714993
N-[2-[(5R)-3-amino-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-5-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide (PubChem CID 126714993) has the molecular formula C17H20F2N6O4S2 and a molecular weight of 474.52 g/mol. Its IUPAC name is N-[2-[(5R)-3-amino-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-5-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide.
| Compound Name | N-[2-[(5R)-3-amino-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-5-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126714993 |
| Molecular Formula | C17H20F2N6O4S2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[2-[(5R)-3-amino-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-5-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
| SMILES | CN1C(N)=N[C@@](C)(c2nc(NC(=O)c3ccc(OC(F)F)cn3)cs2)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C17H20F2N6O4S2/c1-16(2)17(3,24-15(20)25(4)31(16,27)28)13-23-11(8-30-13)22-12(26)10-6-5-9(7-21-10)29-14(18)19/h5-8,14H,1-4H3,(H2,20,24)(H,22,26)/t17-/m0/s1 |
| InChIKey | MTTHTWZIBJNALE-KRWDZBQOSA-N |
| XLogP | 1.98 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |