C17H19BrN4O3S2 — CID 126715052
N-[5-(4-bromo-1,3-thiazol-2-yl)-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-3-yl]benzamide (PubChem CID 126715052) has the molecular formula C17H19BrN4O3S2 and a molecular weight of 471.40 g/mol. Its IUPAC name is N-[5-(4-bromo-1,3-thiazol-2-yl)-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-3-yl]benzamide.
| Compound Name | N-[5-(4-bromo-1,3-thiazol-2-yl)-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-3-yl]benzamide |
|---|---|
| PubChem CID | 126715052 |
| Molecular Formula | C17H19BrN4O3S2 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | N-[5-(4-bromo-1,3-thiazol-2-yl)-2,5,6,6-tetramethyl-1,1-dioxo-1,2,4-thiadiazin-3-yl]benzamide |
| SMILES | CN1C(NC(=O)c2ccccc2)=NC(C)(c2nc(Br)cs2)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C17H19BrN4O3S2/c1-16(2)17(3,14-19-12(18)10-26-14)21-15(22(4)27(16,24)25)20-13(23)11-8-6-5-7-9-11/h5-10H,1-4H3,(H,20,21,23) |
| InChIKey | FXXYBBDSAUCSBY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |