C29H50O — CID 145281350
(Z)-7-(2-ethyl-4-methylcyclopentyl)hept-5-enal;2-pentylcyclohexa-1,3-diene;prop-1-ene (PubChem CID 145281350) has the molecular formula C29H50O and a molecular weight of 414.72 g/mol. Its IUPAC name is (Z)-7-(2-ethyl-4-methylcyclopentyl)hept-5-enal;2-pentylcyclohexa-1,3-diene;prop-1-ene.
| Compound Name | (Z)-7-(2-ethyl-4-methylcyclopentyl)hept-5-enal;2-pentylcyclohexa-1,3-diene;prop-1-ene |
|---|---|
| PubChem CID | 145281350 |
| Molecular Formula | C29H50O |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.39 |
| IUPAC Name | (Z)-7-(2-ethyl-4-methylcyclopentyl)hept-5-enal;2-pentylcyclohexa-1,3-diene;prop-1-ene |
| SMILES | C=CC.CCC1CC(C)CC1C/C=C\CCCC=O.CCCCCC1=CCCC=C1 |
| InChI | InChI=1S/C15H26O.C11H18.C3H6/c1-3-14-11-13(2)12-15(14)9-7-5-4-6-8-10-16;1-2-3-5-8-11-9-6-4-7-10-11;1-3-2/h5,7,10,13-15H,3-4,6,8-9,11-12H2,1-2H3;6,9-10H,2-5,7-8H2,1H3;3H,1H2,2H3/b7-5-;; |
| InChIKey | ASIUIYRJQMSTTM-MWKZNRQPSA-N |
| XLogP | 9.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|