C16H28 — CID 145286517
(1E)-1,5,6-trimethyl-8-prop-2-enylcyclodecene (PubChem CID 145286517) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is (1E)-1,5,6-trimethyl-8-prop-2-enylcyclodecene.
| Compound Name | (1E)-1,5,6-trimethyl-8-prop-2-enylcyclodecene |
|---|---|
| PubChem CID | 145286517 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | (1E)-1,5,6-trimethyl-8-prop-2-enylcyclodecene |
| SMILES | C=CCC1CC/C(C)=C/CCC(C)C(C)C1 |
| InChI | InChI=1S/C16H28/c1-5-7-16-11-10-13(2)8-6-9-14(3)15(4)12-16/h5,8,14-16H,1,6-7,9-12H2,2-4H3/b13-8+ |
| InChIKey | XIWNPHUMMHCLLM-MDWZMJQESA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|