C23H41NO6S — CID 145290817
ethane;3-O-[1-(6-methyloctanoyloxy)ethyl] 4-O-prop-2-enyl 5,5-dimethyl-1,3-thiazolidine-3,4-dicarboxylate (PubChem CID 145290817) has the molecular formula C23H41NO6S and a molecular weight of 459.65 g/mol. Its IUPAC name is ethane;3-O-[1-(6-methyloctanoyloxy)ethyl] 4-O-prop-2-enyl 5,5-dimethyl-1,3-thiazolidine-3,4-dicarboxylate.
| Compound Name | ethane;3-O-[1-(6-methyloctanoyloxy)ethyl] 4-O-prop-2-enyl 5,5-dimethyl-1,3-thiazolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 145290817 |
| Molecular Formula | C23H41NO6S |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | ethane;3-O-[1-(6-methyloctanoyloxy)ethyl] 4-O-prop-2-enyl 5,5-dimethyl-1,3-thiazolidine-3,4-dicarboxylate |
| SMILES | C=CCOC(=O)C1N(C(=O)OC(C)OC(=O)CCCCC(C)CC)CSC1(C)C.CC |
| InChI | InChI=1S/C21H35NO6S.C2H6/c1-7-13-26-19(24)18-21(5,6)29-14-22(18)20(25)28-16(4)27-17(23)12-10-9-11-15(3)8-2;1-2/h7,15-16,18H,1,8-14H2,2-6H3;1-2H3 |
| InChIKey | XHDSXQCMWBEQPL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|