C19H20O2 — CID 145290948
[(3E,5Z)-hepta-3,5-dien-3-yl] 6-methylnaphthalene-2-carboxylate (PubChem CID 145290948) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is [(3E,5Z)-hepta-3,5-dien-3-yl] 6-methylnaphthalene-2-carboxylate.
| Compound Name | [(3E,5Z)-hepta-3,5-dien-3-yl] 6-methylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 145290948 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(3E,5Z)-hepta-3,5-dien-3-yl] 6-methylnaphthalene-2-carboxylate |
| SMILES | C/C=C\C=C(/CC)OC(=O)c1ccc2cc(C)ccc2c1 |
| InChI | InChI=1S/C19H20O2/c1-4-6-7-18(5-2)21-19(20)17-11-10-15-12-14(3)8-9-16(15)13-17/h4,6-13H,5H2,1-3H3/b6-4-,18-7+ |
| InChIKey | DDMQUDMBJOMGTJ-KTHQLFEKSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|