C17H14BrCl — CID 145291155
2-bromo-4-chloro-1-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]benzene (PubChem CID 145291155) has the molecular formula C17H14BrCl and a molecular weight of 333.66 g/mol. Its IUPAC name is 2-bromo-4-chloro-1-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]benzene.
| Compound Name | 2-bromo-4-chloro-1-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 145291155 |
| Molecular Formula | C17H14BrCl |
| Molecular Weight | 333.66 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 2-bromo-4-chloro-1-[(1E)-1-(2-methylphenyl)buta-1,3-dien-2-yl]benzene |
| SMILES | C=C/C(=C\c1ccccc1C)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C17H14BrCl/c1-3-13(10-14-7-5-4-6-12(14)2)16-9-8-15(19)11-17(16)18/h3-11H,1H2,2H3/b13-10+ |
| InChIKey | PKCWFFJKDDCGFW-JLHYYAGUSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|