C22H24N6OS2 — CID 145293529
(methylideneamino) (6Z)-N-[[[6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]methylamino]methyl]quinoline-6-carboximidothioate (PubChem CID 145293529) has the molecular formula C22H24N6OS2 and a molecular weight of 452.61 g/mol. Its IUPAC name is (methylideneamino) (6Z)-N-[[[6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]methylamino]methyl]quinoline-6-carboximidothioate.
| Compound Name | (methylideneamino) (6Z)-N-[[[6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]methylamino]methyl]quinoline-6-carboximidothioate |
|---|---|
| PubChem CID | 145293529 |
| Molecular Formula | C22H24N6OS2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (methylideneamino) (6Z)-N-[[[6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]methylamino]methyl]quinoline-6-carboximidothioate |
| SMILES | C=NS/C(=N\CNCc1ccc(N2CCS(=O)CC2)nc1)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C22H24N6OS2/c1-23-30-22(19-5-6-20-18(13-19)3-2-8-25-20)27-16-24-14-17-4-7-21(26-15-17)28-9-11-31(29)12-10-28/h2-8,13,15,24H,1,9-12,14,16H2/b27-22- |
| InChIKey | VLVPVMMZCYXAME-QYQHSDTDSA-N |
| XLogP | 3.04 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|