About N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine
N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine (PubChem CID 145294045) has the molecular formula C25H33FN2O2
and a molecular weight of 412.55 g/mol. Its IUPAC name is N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine.
Molecular Properties
| Compound Name | N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine |
| PubChem CID | 145294045 |
| Molecular Formula | C25H33FN2O2 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine |
| SMILES | CCNC1CCOc2ccc(F)cc21.c1ccc(C2CCOC3(CCCC3)C2)nc1 |
| InChI | InChI=1S/C14H19NO.C11H14FNO/c1-4-9-15-13(5-1)12-6-10-16-14(11-12)7-2-3-8-14;1-2-13-10-5-6-14-11-4-3-8(12)7-9(10)11/h1,4-5,9,12H,2-3,6-8,10-11H2;3-4,7,10,13H,2,5-6H2,1H3 |
| InChIKey | QKPPMWCYUUNDKS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine?
The IUPAC name of N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine (CID 145294045) is N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine.
What is the SMILES notation for N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine?
The canonical SMILES for N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine is CCNC1CCOc2ccc(F)cc21.c1ccc(C2CCOC3(CCCC3)C2)nc1.
What is the InChIKey of N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine?
The InChIKey is QKPPMWCYUUNDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO.C11H14FNO/c1-4-9-15-13(5-1)12-6-10-16-14(11-12)7-2-3-8-14;1-2-13-10-5-6-14-11-4-3-8(12)7-9(10)11/h1,4-5,9,12H,2-3,6-8,10-11H2;3-4,7,10,13H,2,5-6H2,1H3.
What are the key properties of N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine?
N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine has a molecular weight of 412.55 g/mol, XLogP of 5.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-amine;2-(6-oxaspiro[4.5]decan-9-yl)pyridine is sourced from PubChem (CID 145294045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).