C25H35N4O4S+ — CID 145298022
2-[[2-[3-[3-(4-methoxycarbonyl-1,3-oxazol-2-yl)azetidin-1-yl]propyl]benzimidazol-1-yl]methoxy]ethyl-methyl-propan-2-ylsulfanium (PubChem CID 145298022) has the molecular formula C25H35N4O4S+ and a molecular weight of 487.65 g/mol. Its IUPAC name is 2-[[2-[3-[3-(4-methoxycarbonyl-1,3-oxazol-2-yl)azetidin-1-yl]propyl]benzimidazol-1-yl]methoxy]ethyl-methyl-propan-2-ylsulfanium.
| Compound Name | 2-[[2-[3-[3-(4-methoxycarbonyl-1,3-oxazol-2-yl)azetidin-1-yl]propyl]benzimidazol-1-yl]methoxy]ethyl-methyl-propan-2-ylsulfanium |
|---|---|
| PubChem CID | 145298022 |
| Molecular Formula | C25H35N4O4S+ |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 2-[[2-[3-[3-(4-methoxycarbonyl-1,3-oxazol-2-yl)azetidin-1-yl]propyl]benzimidazol-1-yl]methoxy]ethyl-methyl-propan-2-ylsulfanium |
| SMILES | COC(=O)c1coc(C2CN(CCCc3nc4ccccc4n3COCC[S+](C)C(C)C)C2)n1 |
| InChI | InChI=1S/C25H35N4O4S/c1-18(2)34(4)13-12-32-17-29-22-9-6-5-8-20(22)26-23(29)10-7-11-28-14-19(15-28)24-27-21(16-33-24)25(30)31-3/h5-6,8-9,16,18-19H,7,10-15,17H2,1-4H3/q+1 |
| InChIKey | WKTNVRUSLIPKJQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 82.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|