C36H38N4O — CID 145300330
[4-[(1R,8R)-10-benzyl-9-methyl-9,10-diazatricyclo[6.4.1.02,7]trideca-2(7),3,5-trien-5-yl]piperazin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 145300330) has the molecular formula C36H38N4O and a molecular weight of 542.73 g/mol. Its IUPAC name is [4-[(1R,8R)-10-benzyl-9-methyl-9,10-diazatricyclo[6.4.1.02,7]trideca-2(7),3,5-trien-5-yl]piperazin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [4-[(1R,8R)-10-benzyl-9-methyl-9,10-diazatricyclo[6.4.1.02,7]trideca-2(7),3,5-trien-5-yl]piperazin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 145300330 |
| Molecular Formula | C36H38N4O |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | [4-[(1R,8R)-10-benzyl-9-methyl-9,10-diazatricyclo[6.4.1.02,7]trideca-2(7),3,5-trien-5-yl]piperazin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | CN1[C@@H]2C[C@@H](CCN1Cc1ccccc1)c1ccc(N3CCN(C(=O)c4ccc(-c5ccccc5)cc4)CC3)cc12 |
| InChI | InChI=1S/C36H38N4O/c1-37-35-24-31(18-19-40(37)26-27-8-4-2-5-9-27)33-17-16-32(25-34(33)35)38-20-22-39(23-21-38)36(41)30-14-12-29(13-15-30)28-10-6-3-7-11-28/h2-17,25,31,35H,18-24,26H2,1H3/t31-,35-/m1/s1 |
| InChIKey | NZQXQKIXQGJHEL-CYEXUTLASA-N |
| XLogP | 6.60 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |