C7H15N3 — CID 145301468
7-methyl-1,2,3,4,4a,5,6,7a-octahydropyrrolo[2,3-c]pyridazine (PubChem CID 145301468) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is 7-methyl-1,2,3,4,4a,5,6,7a-octahydropyrrolo[2,3-c]pyridazine.
| Compound Name | 7-methyl-1,2,3,4,4a,5,6,7a-octahydropyrrolo[2,3-c]pyridazine |
|---|---|
| PubChem CID | 145301468 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 7-methyl-1,2,3,4,4a,5,6,7a-octahydropyrrolo[2,3-c]pyridazine |
| SMILES | CN1CCC2CCNNC21 |
| InChI | InChI=1S/C7H15N3/c1-10-5-3-6-2-4-8-9-7(6)10/h6-9H,2-5H2,1H3 |
| InChIKey | WVRFLOLFIRFLDU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |