C29H48O2 — CID 145304657
17-(5,5-dimethylhexyl)-3-hydroxy-4,4,9,13-tetramethyl-2,3,7,8,10,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-one (PubChem CID 145304657) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is 17-(5,5-dimethylhexyl)-3-hydroxy-4,4,9,13-tetramethyl-2,3,7,8,10,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-one.
| Compound Name | 17-(5,5-dimethylhexyl)-3-hydroxy-4,4,9,13-tetramethyl-2,3,7,8,10,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 145304657 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | 17-(5,5-dimethylhexyl)-3-hydroxy-4,4,9,13-tetramethyl-2,3,7,8,10,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-one |
| SMILES | CC(C)(C)CCCCC1CCC2C3CC=C4C(CCC(O)C4(C)C)C3(C)C(=O)CC12C |
| InChI | InChI=1S/C29H48O2/c1-26(2,3)17-9-8-10-19-11-12-21-23-14-13-20-22(15-16-24(30)27(20,4)5)29(23,7)25(31)18-28(19,21)6/h13,19,21-24,30H,8-12,14-18H2,1-7H3 |
| InChIKey | KXXGKAOEZOPVTJ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|