C11H18N2OS — CID 145305584
ethane;2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 145305584) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is ethane;2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | ethane;2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 145305584 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | ethane;2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CC.O=Cc1cnc(CN2CCCC2)s1 |
| InChI | InChI=1S/C9H12N2OS.C2H6/c12-7-8-5-10-9(13-8)6-11-3-1-2-4-11;1-2/h5,7H,1-4,6H2;1-2H3 |
| InChIKey | VGVVCYSSPUIQKO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|