C25H33ClF2N3O3+ — CID 145309802
2-chloro-4-[4-(3,3-difluoro-2-hydroxy-1-oxo-2-prop-1-en-2-yl-4-azoniaspiro[3.5]nonan-7-yl)piperidin-1-yl]-N,N-dimethylbenzamide (PubChem CID 145309802) has the molecular formula C25H33ClF2N3O3+ and a molecular weight of 497.01 g/mol. Its IUPAC name is 2-chloro-4-[4-(3,3-difluoro-2-hydroxy-1-oxo-2-prop-1-en-2-yl-4-azoniaspiro[3.5]nonan-7-yl)piperidin-1-yl]-N,N-dimethylbenzamide.
| Compound Name | 2-chloro-4-[4-(3,3-difluoro-2-hydroxy-1-oxo-2-prop-1-en-2-yl-4-azoniaspiro[3.5]nonan-7-yl)piperidin-1-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 145309802 |
| Molecular Formula | C25H33ClF2N3O3+ |
| Molecular Weight | 497.01 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 2-chloro-4-[4-(3,3-difluoro-2-hydroxy-1-oxo-2-prop-1-en-2-yl-4-azoniaspiro[3.5]nonan-7-yl)piperidin-1-yl]-N,N-dimethylbenzamide |
| SMILES | C=C(C)C1(O)C(=O)[N+]2(CCC(C3CCN(c4ccc(C(=O)N(C)C)c(Cl)c4)CC3)CC2)C1(F)F |
| InChI | InChI=1S/C25H33ClF2N3O3/c1-16(2)24(34)23(33)31(25(24,27)28)13-9-18(10-14-31)17-7-11-30(12-8-17)19-5-6-20(21(26)15-19)22(32)29(3)4/h5-6,15,17-18,34H,1,7-14H2,2-4H3/q+1 |
| InChIKey | KVQAZXKEQMHZNJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.01 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|