C24H31ClN2O4S — CID 166745093
3-[1-[1-[3-chloro-4-(dimethylcarbamoyl)phenyl]piperidin-4-yl]propyl]-4-methylbenzenesulfonic acid (PubChem CID 166745093) has the molecular formula C24H31ClN2O4S and a molecular weight of 479.04 g/mol. Its IUPAC name is 3-[1-[1-[3-chloro-4-(dimethylcarbamoyl)phenyl]piperidin-4-yl]propyl]-4-methylbenzenesulfonic acid.
| Compound Name | 3-[1-[1-[3-chloro-4-(dimethylcarbamoyl)phenyl]piperidin-4-yl]propyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 166745093 |
| Molecular Formula | C24H31ClN2O4S |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 3-[1-[1-[3-chloro-4-(dimethylcarbamoyl)phenyl]piperidin-4-yl]propyl]-4-methylbenzenesulfonic acid |
| SMILES | CCC(c1cc(S(=O)(=O)O)ccc1C)C1CCN(c2ccc(C(=O)N(C)C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C24H31ClN2O4S/c1-5-20(22-15-19(32(29,30)31)8-6-16(22)2)17-10-12-27(13-11-17)18-7-9-21(23(25)14-18)24(28)26(3)4/h6-9,14-15,17,20H,5,10-13H2,1-4H3,(H,29,30,31) |
| InChIKey | ONBZEYOOHIVDDW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|