C19H31N5O — CID 145312573
2-[1-[(2E,3Z)-2,3-di(ethylidene)-4,4-dimethylpyrrolidin-1-yl]-1-(ethyliminomethylimino)propan-2-yl]iminopropanamide (PubChem CID 145312573) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-[1-[(2E,3Z)-2,3-di(ethylidene)-4,4-dimethylpyrrolidin-1-yl]-1-(ethyliminomethylimino)propan-2-yl]iminopropanamide.
| Compound Name | 2-[1-[(2E,3Z)-2,3-di(ethylidene)-4,4-dimethylpyrrolidin-1-yl]-1-(ethyliminomethylimino)propan-2-yl]iminopropanamide |
|---|---|
| PubChem CID | 145312573 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 2-[1-[(2E,3Z)-2,3-di(ethylidene)-4,4-dimethylpyrrolidin-1-yl]-1-(ethyliminomethylimino)propan-2-yl]iminopropanamide |
| SMILES | C/C=C1C(=C/C)\N(/C(=N/C=N/CC)C(C)/N=C(\C)C(N)=O)CC\1(C)C |
| InChI | InChI=1S/C19H31N5O/c1-8-15-16(9-2)24(11-19(15,6)7)18(22-12-21-10-3)14(5)23-13(4)17(20)25/h8-9,12,14H,10-11H2,1-7H3,(H2,20,25)/b15-8+,16-9+,21-12+,22-18+,23-13+ |
| InChIKey | AOICCRMAJXXZMB-RVVUPBSKSA-N |
| XLogP | 2.96 |
| TPSA | 83.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|