About dichloro(propyl)silane;prop-2-enamide
dichloro(propyl)silane;prop-2-enamide (PubChem CID 159453963) has the molecular formula C6H13Cl2NOSi
and a molecular weight of 214.17 g/mol. Its IUPAC name is dichloro(propyl)silane;prop-2-enamide.
Molecular Properties
| Compound Name | dichloro(propyl)silane;prop-2-enamide |
| PubChem CID | 159453963 |
| Molecular Formula | C6H13Cl2NOSi |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | dichloro(propyl)silane;prop-2-enamide |
| SMILES | C=CC(N)=O.CCC[SiH](Cl)Cl |
| InChI | InChI=1S/C3H8Cl2Si.C3H5NO/c1-2-3-6(4)5;1-2-3(4)5/h6H,2-3H2,1H3;2H,1H2,(H2,4,5) |
| InChIKey | LTSPBEFFRVIUCR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro(propyl)silane;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(propyl)silane;prop-2-enamide?
The IUPAC name of dichloro(propyl)silane;prop-2-enamide (CID 159453963) is dichloro(propyl)silane;prop-2-enamide.
What is the SMILES notation for dichloro(propyl)silane;prop-2-enamide?
The canonical SMILES for dichloro(propyl)silane;prop-2-enamide is C=CC(N)=O.CCC[SiH](Cl)Cl.
What is the InChIKey of dichloro(propyl)silane;prop-2-enamide?
The InChIKey is LTSPBEFFRVIUCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8Cl2Si.C3H5NO/c1-2-3-6(4)5;1-2-3(4)5/h6H,2-3H2,1H3;2H,1H2,(H2,4,5).
What are the key properties of dichloro(propyl)silane;prop-2-enamide?
dichloro(propyl)silane;prop-2-enamide has a molecular weight of 214.17 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(propyl)silane;prop-2-enamide is sourced from PubChem (CID 159453963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).