C15H14N2O2S2 — CID 145316942
(NE)-N-(5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)naphthalene-1-sulfinamide (PubChem CID 145316942) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (NE)-N-(5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)naphthalene-1-sulfinamide.
| Compound Name | (NE)-N-(5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)naphthalene-1-sulfinamide |
|---|---|
| PubChem CID | 145316942 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (NE)-N-(5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)naphthalene-1-sulfinamide |
| SMILES | CCC1S/C(=N/S(=O)c2cccc3ccccc23)NC1=O |
| InChI | InChI=1S/C15H14N2O2S2/c1-2-12-14(18)16-15(20-12)17-21(19)13-9-5-7-10-6-3-4-8-11(10)13/h3-9,12H,2H2,1H3,(H,16,17,18) |
| InChIKey | ZLIHNVKCYAYYKO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|