C13H23N3O — CID 145324568
(3E,5E)-3-methoxy-5-(piperazin-1-ylmethyl)hepta-1,3,5-trien-2-amine (PubChem CID 145324568) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is (3E,5E)-3-methoxy-5-(piperazin-1-ylmethyl)hepta-1,3,5-trien-2-amine.
| Compound Name | (3E,5E)-3-methoxy-5-(piperazin-1-ylmethyl)hepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 145324568 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | (3E,5E)-3-methoxy-5-(piperazin-1-ylmethyl)hepta-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C(=C\C(=C/C)CN1CCNCC1)OC |
| InChI | InChI=1S/C13H23N3O/c1-4-12(9-13(17-3)11(2)14)10-16-7-5-15-6-8-16/h4,9,15H,2,5-8,10,14H2,1,3H3/b12-4+,13-9+ |
| InChIKey | ZSNYFPPGUBQCMR-VJWGLOJXSA-N |
| XLogP | 0.84 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|