C16H31NO — CID 145332821
(2E,5E)-4-[3-(diethylamino)propyl]-3,5-dimethylhepta-2,5-dien-4-ol (PubChem CID 145332821) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is (2E,5E)-4-[3-(diethylamino)propyl]-3,5-dimethylhepta-2,5-dien-4-ol.
| Compound Name | (2E,5E)-4-[3-(diethylamino)propyl]-3,5-dimethylhepta-2,5-dien-4-ol |
|---|---|
| PubChem CID | 145332821 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | (2E,5E)-4-[3-(diethylamino)propyl]-3,5-dimethylhepta-2,5-dien-4-ol |
| SMILES | C/C=C(\C)C(O)(CCCN(CC)CC)/C(C)=C/C |
| InChI | InChI=1S/C16H31NO/c1-7-14(5)16(18,15(6)8-2)12-11-13-17(9-3)10-4/h7-8,18H,9-13H2,1-6H3/b14-7+,15-8+ |
| InChIKey | FEDRLFFIKUZDEE-IROCBMIISA-N |
| XLogP | 3.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|