C8H11FN8 — CID 145336818
2-N-[(Z)-1-amino-2-fluoro-2-hydrazinylethenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 145336818) has the molecular formula C8H11FN8 and a molecular weight of 238.23 g/mol. Its IUPAC name is 2-N-[(Z)-1-amino-2-fluoro-2-hydrazinylethenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(Z)-1-amino-2-fluoro-2-hydrazinylethenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145336818 |
| Molecular Formula | C8H11FN8 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-N-[(Z)-1-amino-2-fluoro-2-hydrazinylethenyl]-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | NN/C(F)=C(\N)Nc1nc(N)c2cc[nH]c2n1 |
| InChI | InChI=1S/C8H11FN8/c9-4(17-12)6(11)15-8-14-5(10)3-1-2-13-7(3)16-8/h1-2,17H,11-12H2,(H4,10,13,14,15,16)/b6-4+ |
| InChIKey | UTJFKCXGPBFRTH-GQCTYLIASA-N |
| XLogP | -0.53 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|