C15H16O — CID 145337056
1-(6-methylcyclohexa-1,5-dien-1-yl)-2-phenylethanone (PubChem CID 145337056) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(6-methylcyclohexa-1,5-dien-1-yl)-2-phenylethanone.
| Compound Name | 1-(6-methylcyclohexa-1,5-dien-1-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 145337056 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(6-methylcyclohexa-1,5-dien-1-yl)-2-phenylethanone |
| SMILES | CC1=CCCC=C1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H16O/c1-12-7-5-6-10-14(12)15(16)11-13-8-3-2-4-9-13/h2-4,7-10H,5-6,11H2,1H3 |
| InChIKey | FYCSZEFLHIKJDG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |