About N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane
N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane (PubChem CID 145338320) has the molecular formula C13H30N4
and a molecular weight of 242.41 g/mol. Its IUPAC name is N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane.
Molecular Properties
| Compound Name | N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane |
| PubChem CID | 145338320 |
| Molecular Formula | C13H30N4 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.25 |
| IUPAC Name | N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane |
| SMILES | C=CNCCN1CCNCC1.CC(C)C.[H]N=C |
| InChI | InChI=1S/C8H17N3.C4H10.CH3N/c1-2-9-3-6-11-7-4-10-5-8-11;1-4(2)3;1-2/h2,9-10H,1,3-8H2;4H,1-3H3;2H,1H2 |
| InChIKey | WDBXWERNEHEGLY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 51.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane?
The IUPAC name of N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane (CID 145338320) is N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane.
What is the SMILES notation for N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane?
The canonical SMILES for N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane is C=CNCCN1CCNCC1.CC(C)C.[H]N=C.
What is the InChIKey of N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane?
The InChIKey is WDBXWERNEHEGLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3.C4H10.CH3N/c1-2-9-3-6-11-7-4-10-5-8-11;1-4(2)3;1-2/h2,9-10H,1,3-8H2;4H,1-3H3;2H,1H2.
What are the key properties of N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane?
N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane has a molecular weight of 242.41 g/mol, XLogP of 1.55, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-2-piperazin-1-ylethanamine;methanimine;2-methylpropane is sourced from PubChem (CID 145338320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).