C14H20F3NO — CID 145338860
N-[(2,5-dimethylphenyl)methyl]-N-(2,2,2-trifluoroethyl)formamide;ethane (PubChem CID 145338860) has the molecular formula C14H20F3NO and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]-N-(2,2,2-trifluoroethyl)formamide;ethane.
| Compound Name | N-[(2,5-dimethylphenyl)methyl]-N-(2,2,2-trifluoroethyl)formamide;ethane |
|---|---|
| PubChem CID | 145338860 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[(2,5-dimethylphenyl)methyl]-N-(2,2,2-trifluoroethyl)formamide;ethane |
| SMILES | CC.Cc1ccc(C)c(CN(C=O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO.C2H6/c1-9-3-4-10(2)11(5-9)6-16(8-17)7-12(13,14)15;1-2/h3-5,8H,6-7H2,1-2H3;1-2H3 |
| InChIKey | JCUITIGFJMXUDB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|