C29H28N2 — CID 145339548
10-ethenyl-9-[(Z)-prop-1-enyl]-N-[(2Z,4Z)-2-pyrrol-1-ylhexa-2,4-dien-3-yl]phenanthren-3-amine (PubChem CID 145339548) has the molecular formula C29H28N2 and a molecular weight of 404.56 g/mol. Its IUPAC name is 10-ethenyl-9-[(Z)-prop-1-enyl]-N-[(2Z,4Z)-2-pyrrol-1-ylhexa-2,4-dien-3-yl]phenanthren-3-amine.
| Compound Name | 10-ethenyl-9-[(Z)-prop-1-enyl]-N-[(2Z,4Z)-2-pyrrol-1-ylhexa-2,4-dien-3-yl]phenanthren-3-amine |
|---|---|
| PubChem CID | 145339548 |
| Molecular Formula | C29H28N2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 10-ethenyl-9-[(Z)-prop-1-enyl]-N-[(2Z,4Z)-2-pyrrol-1-ylhexa-2,4-dien-3-yl]phenanthren-3-amine |
| SMILES | C=Cc1c(/C=C\C)c2ccccc2c2cc(NC(/C=C\C)=C(/C)n3cccc3)ccc12 |
| InChI | InChI=1S/C29H28N2/c1-5-12-24-23(7-3)27-17-16-22(20-28(27)26-15-9-8-14-25(24)26)30-29(13-6-2)21(4)31-18-10-11-19-31/h5-20,30H,3H2,1-2,4H3/b12-5-,13-6-,29-21- |
| InChIKey | XMRKRUAMNNZTLQ-ZALYJPFISA-N |
| XLogP | 8.35 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|