C46H40N6 — CID 145345226
6-(3,6-ditert-butylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)pyrido[3,2-b]indole (PubChem CID 145345226) has the molecular formula C46H40N6 and a molecular weight of 676.87 g/mol. Its IUPAC name is 6-(3,6-ditert-butylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)pyrido[3,2-b]indole.
| Compound Name | 6-(3,6-ditert-butylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 145345226 |
| Molecular Formula | C46H40N6 |
| Molecular Weight | 676.87 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | 6-(3,6-ditert-butylcarbazol-9-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)pyrido[3,2-b]indole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cccc2c3ncccc3n(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c12 |
| InChI | InChI=1S/C46H40N6/c1-45(2,3)31-22-24-36-34(27-31)35-28-32(46(4,5)6)23-25-37(35)51(36)39-20-13-19-33-40-38(21-14-26-47-40)52(41(33)39)44-49-42(29-15-9-7-10-16-29)48-43(50-44)30-17-11-8-12-18-30/h7-28H,1-6H3 |
| InChIKey | MZQKARXOPHOKGY-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.87 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |