C15H16FN3O3 — CID 145347411
ethyl 2-[1-[3-(aziridin-2-yl)-5-fluorophenyl]pyrazol-3-yl]oxyacetate (PubChem CID 145347411) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is ethyl 2-[1-[3-(aziridin-2-yl)-5-fluorophenyl]pyrazol-3-yl]oxyacetate.
| Compound Name | ethyl 2-[1-[3-(aziridin-2-yl)-5-fluorophenyl]pyrazol-3-yl]oxyacetate |
|---|---|
| PubChem CID | 145347411 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | ethyl 2-[1-[3-(aziridin-2-yl)-5-fluorophenyl]pyrazol-3-yl]oxyacetate |
| SMILES | CCOC(=O)COc1ccn(-c2cc(F)cc(C3CN3)c2)n1 |
| InChI | InChI=1S/C15H16FN3O3/c1-2-21-15(20)9-22-14-3-4-19(18-14)12-6-10(13-8-17-13)5-11(16)7-12/h3-7,13,17H,2,8-9H2,1H3 |
| InChIKey | DJEVDFOGRPOEDW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|