C22H26N2 — CID 145347904
11,12-dihydroimidazo[1,2-f]phenanthridine;methylcyclopropane;prop-1-ene (PubChem CID 145347904) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 11,12-dihydroimidazo[1,2-f]phenanthridine;methylcyclopropane;prop-1-ene.
| Compound Name | 11,12-dihydroimidazo[1,2-f]phenanthridine;methylcyclopropane;prop-1-ene |
|---|---|
| PubChem CID | 145347904 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 11,12-dihydroimidazo[1,2-f]phenanthridine;methylcyclopropane;prop-1-ene |
| SMILES | C1=Cc2c(c3nccn3c3ccccc23)CC1.C=CC.CC1CC1 |
| InChI | InChI=1S/C15H12N2.C4H8.C3H6/c1-2-7-13-11(5-1)12-6-3-4-8-14(12)17-10-9-16-15(13)17;1-4-2-3-4;1-3-2/h1,3-6,8-10H,2,7H2;4H,2-3H2,1H3;3H,1H2,2H3 |
| InChIKey | ZTCQYIODXFGDTN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|